Swcros
-sucrose.svg) | |
| Enghraifft o: | math o endid cemegol, melysydd  |
|---|---|
| Math | hex-2-ulofuranosyl hexopyranoside |
| Màs | 342.116 uned Dalton |
| Fformiwla gemegol | C₁₂h₂₂o₁₁ |
| Rhan o | sucrose metabolic process, sucrose biosynthetic process, sucrose catabolic process, response to sucrose, sucrose catabolic process via 3'-ketosucrose, glycolytic process from sucrose, sucrose catabolic process to fructose-6-phosphate through glucose and fructose, cellular response to sucrose stimulus, sucrose:proton symporter activity, sucrose transmembrane transporter activity, sucrose:cation symporter activity, sucrose transmembrane transport, sucrose transport, sucrose catabolic process to fructose-6-phosphate and glucose-6-phosphate, sucrose phosphorylase activity, glucoside 3-dehydrogenase activity, raffinose-raffinose alpha-galactotransferase activity, sucrose 6F-alpha-galactotransferase activity, galactinol-sucrose galactosyltransferase activity, isomaltulose synthase activity, sucrose 1F-fructosyltransferase activity, sucrose-phosphate phosphatase activity, inulosucrase activity, amylosucrase activity, levansucrase activity, sucrose alpha-glucosidase activity, protein-N(PI)-phosphohistidine-sucrose phosphotransferase system transporter activity |
| Yn cynnwys | ocsigen, carbon, hydrogen |
| Dynodwyr | |
| SMILES | C(c1c(c(c(c(o1)oc2(c(c(c(o2)co)o)o)co)o)o)o)o |
| Thesawrws NCI | C68477 |
| Freebase | /M/0dcfv |
| Thesawrws y BNCF | 15553 |
| CAS | 57-50-1 |
| PubChem CID | 5988 |
| ChEBI | 17992 |
| InChI | Inchi=1s/c12h22o11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20h,1-3h2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| ChEMBL | Chembl253582 |
| ChemSpider | 5768 |
| UNII | C151h8m554 |
| KEGG | D00025 |
| Llawlyfr Ligand | 5411 |
| Rhif EC | 200-334-9 |
| Cofrestr Beilstein | 1435311, 90825 |
| Drugbank | Db02772 |
| ECHA | 100.000.304 |
| HMDB | Hmdb0000258 |
| RxNorm CUI | 10159 |
| NDF-RT | N0000147528 |
| Quora | Sucrose |
| IEDB Epitope | 153236 |
 Ffeiliau perthnasol ar Gomin Wicimedia | |
Deusacarid gwyn crisialog melys a geir mewn planhigion yw swcros. Hwn yw'r siwgr a geir mewn siwgr bord, siwgr mân, a siwgr eisin.[1]
Cyfeiriadau
[golygu | golygu cod]- ↑ Crystal, David (gol.). The Penguin Encyclopedia (Llundain, Penguin, 2004), t. 1476.
